C14H22O8 — CID 174976815
ethane-1,2-diol;bis(2-(oxiran-2-ylmethyl)prop-2-enoic acid) (PubChem CID 174976815) has the molecular formula C14H22O8 and a molecular weight of 318.32 g/mol. Its IUPAC name is ethane-1,2-diol;bis(2-(oxiran-2-ylmethyl)prop-2-enoic acid).
| Compound Name | ethane-1,2-diol;bis(2-(oxiran-2-ylmethyl)prop-2-enoic acid) |
|---|---|
| PubChem CID | 174976815 |
| Molecular Formula | C14H22O8 |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | ethane-1,2-diol;bis(2-(oxiran-2-ylmethyl)prop-2-enoic acid) |
| SMILES | C=C(CC1CO1)C(=O)O.C=C(CC1CO1)C(=O)O.OCCO |
| InChI | InChI=1S/2C6H8O3.C2H6O2/c2*1-4(6(7)8)2-5-3-9-5;3-1-2-4/h2*5H,1-3H2,(H,7,8);3-4H,1-2H2 |
| InChIKey | ALQSSNFHGCEAIV-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 140.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|