C7H11NO3 — CID 68522926
2-(1,3-oxazolidin-2-ylmethyl)prop-2-enoic acid (PubChem CID 68522926) has the molecular formula C7H11NO3 and a molecular weight of 157.17 g/mol. Its IUPAC name is 2-(1,3-oxazolidin-2-ylmethyl)prop-2-enoic acid.
| Compound Name | 2-(1,3-oxazolidin-2-ylmethyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 68522926 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | 2-(1,3-oxazolidin-2-ylmethyl)prop-2-enoic acid |
| SMILES | C=C(CC1NCCO1)C(=O)O |
| InChI | InChI=1S/C7H11NO3/c1-5(7(9)10)4-6-8-2-3-11-6/h6,8H,1-4H2,(H,9,10) |
| InChIKey | YRYFFHUACXWXFU-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|