2-(1,3-oxazolidin-2-yl)-2-oxoacetic acid

C5H7NO4 — CID 174974920

IUPAC2-(1,3-oxazolidin-2-yl)-2-oxoacetic acid
SMILESO=C(O)C(=O)C1NCCO1
InChIInChI=1S/C5H7NO4/c7-3(5(8)9)4-6-1-2-10-4/h4,6H,1-2H2,(H,8,9)
InChIKeyUKXLXFDCMPZEJR-UHFFFAOYSA-N
MW145.11 g/mol
LogP-1.41
Rot. Bonds2

About 2-(1,3-oxazolidin-2-yl)-2-oxoacetic acid

2-(1,3-oxazolidin-2-yl)-2-oxoacetic acid (PubChem CID 174974920) has the molecular formula C5H7NO4 and a molecular weight of 145.11 g/mol. Its IUPAC name is 2-(1,3-oxazolidin-2-yl)-2-oxoacetic acid.

Molecular Properties

Compound Name2-(1,3-oxazolidin-2-yl)-2-oxoacetic acid
PubChem CID174974920
Molecular FormulaC5H7NO4
Molecular Weight145.11 g/mol
Exact Mass145.04
IUPAC Name2-(1,3-oxazolidin-2-yl)-2-oxoacetic acid
SMILESO=C(O)C(=O)C1NCCO1
InChIInChI=1S/C5H7NO4/c7-3(5(8)9)4-6-1-2-10-4/h4,6H,1-2H2,(H,8,9)
InChIKeyUKXLXFDCMPZEJR-UHFFFAOYSA-N
XLogP-1.41
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500145.11
LogP ≤ 5-1.41
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze 2-(1,3-oxazolidin-2-yl)-2-oxoacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,3-oxazolidin-2-yl)-2-oxoacetic acid?
The IUPAC name of 2-(1,3-oxazolidin-2-yl)-2-oxoacetic acid (CID 174974920) is 2-(1,3-oxazolidin-2-yl)-2-oxoacetic acid.
What is the SMILES notation for 2-(1,3-oxazolidin-2-yl)-2-oxoacetic acid?
The canonical SMILES for 2-(1,3-oxazolidin-2-yl)-2-oxoacetic acid is O=C(O)C(=O)C1NCCO1.
What is the InChIKey of 2-(1,3-oxazolidin-2-yl)-2-oxoacetic acid?
The InChIKey is UKXLXFDCMPZEJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NO4/c7-3(5(8)9)4-6-1-2-10-4/h4,6H,1-2H2,(H,8,9).
What are the key properties of 2-(1,3-oxazolidin-2-yl)-2-oxoacetic acid?
2-(1,3-oxazolidin-2-yl)-2-oxoacetic acid has a molecular weight of 145.11 g/mol, XLogP of -1.41, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-oxazolidin-2-yl)-2-oxoacetic acid is sourced from PubChem (CID 174974920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).