C10H11NO2 — CID 154118649
1,3-oxazolidin-2-yl(phenyl)methanone (PubChem CID 154118649) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is 1,3-oxazolidin-2-yl(phenyl)methanone.
| Compound Name | 1,3-oxazolidin-2-yl(phenyl)methanone |
|---|---|
| PubChem CID | 154118649 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 1,3-oxazolidin-2-yl(phenyl)methanone |
| SMILES | O=C(c1ccccc1)C1NCCO1 |
| InChI | InChI=1S/C10H11NO2/c12-9(10-11-6-7-13-10)8-4-2-1-3-5-8/h1-5,10-11H,6-7H2 |
| InChIKey | RSVUWERPAVTSKU-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |