C10H12ClNOS — CID 138398651
phenyl(1,3-thiazolidin-2-yl)methanone;hydrochloride (PubChem CID 138398651) has the molecular formula C10H12ClNOS and a molecular weight of 229.73 g/mol. Its IUPAC name is phenyl(1,3-thiazolidin-2-yl)methanone;hydrochloride.
| Compound Name | phenyl(1,3-thiazolidin-2-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 138398651 |
| Molecular Formula | C10H12ClNOS |
| Molecular Weight | 229.73 g/mol |
| Exact Mass | 229.03 |
| IUPAC Name | phenyl(1,3-thiazolidin-2-yl)methanone;hydrochloride |
| SMILES | Cl.O=C(c1ccccc1)C1NCCS1 |
| InChI | InChI=1S/C10H11NOS.ClH/c12-9(10-11-6-7-13-10)8-4-2-1-3-5-8;/h1-5,10-11H,6-7H2;1H |
| InChIKey | MGDSCKXLECXVPV-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.73 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |