About phenyl(1,3-thiazolidin-2-yl)methanone;hydrochloride
phenyl(1,3-thiazolidin-2-yl)methanone;hydrochloride (PubChem CID 138398651) has the molecular formula C10H12ClNOS
and a molecular weight of 229.73 g/mol. Its IUPAC name is phenyl(1,3-thiazolidin-2-yl)methanone;hydrochloride.
Molecular Properties
| Compound Name | phenyl(1,3-thiazolidin-2-yl)methanone;hydrochloride |
| PubChem CID | 138398651 |
| Molecular Formula | C10H12ClNOS |
| Molecular Weight | 229.73 g/mol |
| Exact Mass | 229.03 |
| IUPAC Name | phenyl(1,3-thiazolidin-2-yl)methanone;hydrochloride |
| SMILES | Cl.O=C(c1ccccc1)C1NCCS1 |
| InChI | InChI=1S/C10H11NOS.ClH/c12-9(10-11-6-7-13-10)8-4-2-1-3-5-8;/h1-5,10-11H,6-7H2;1H |
| InChIKey | MGDSCKXLECXVPV-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.73 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze phenyl(1,3-thiazolidin-2-yl)methanone;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl(1,3-thiazolidin-2-yl)methanone;hydrochloride?
The IUPAC name of phenyl(1,3-thiazolidin-2-yl)methanone;hydrochloride (CID 138398651) is phenyl(1,3-thiazolidin-2-yl)methanone;hydrochloride.
What is the SMILES notation for phenyl(1,3-thiazolidin-2-yl)methanone;hydrochloride?
The canonical SMILES for phenyl(1,3-thiazolidin-2-yl)methanone;hydrochloride is Cl.O=C(c1ccccc1)C1NCCS1.
What is the InChIKey of phenyl(1,3-thiazolidin-2-yl)methanone;hydrochloride?
The InChIKey is MGDSCKXLECXVPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NOS.ClH/c12-9(10-11-6-7-13-10)8-4-2-1-3-5-8;/h1-5,10-11H,6-7H2;1H.
What are the key properties of phenyl(1,3-thiazolidin-2-yl)methanone;hydrochloride?
phenyl(1,3-thiazolidin-2-yl)methanone;hydrochloride has a molecular weight of 229.73 g/mol, XLogP of 1.95, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl(1,3-thiazolidin-2-yl)methanone;hydrochloride is sourced from PubChem (CID 138398651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).