C7H12FeN2OS2 — CID 175441879
bis(1,3-thiazolidin-2-yl)methanone;iron (PubChem CID 175441879) has the molecular formula C7H12FeN2OS2 and a molecular weight of 260.17 g/mol. Its IUPAC name is bis(1,3-thiazolidin-2-yl)methanone;iron.
| Compound Name | bis(1,3-thiazolidin-2-yl)methanone;iron |
|---|---|
| PubChem CID | 175441879 |
| Molecular Formula | C7H12FeN2OS2 |
| Molecular Weight | 260.17 g/mol |
| Exact Mass | 259.97 |
| IUPAC Name | bis(1,3-thiazolidin-2-yl)methanone;iron |
| SMILES | O=C(C1NCCS1)C1NCCS1.[Fe] |
| InChI | InChI=1S/C7H12N2OS2.Fe/c10-5(6-8-1-3-11-6)7-9-2-4-12-7;/h6-9H,1-4H2; |
| InChIKey | ZSYLODIYOHOHDI-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.17 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|