C10H18N2O4S — CID 67719115
piperidine-2-carboxylic acid;1,3-thiazolidine-2-carboxylic acid (PubChem CID 67719115) has the molecular formula C10H18N2O4S and a molecular weight of 262.33 g/mol. Its IUPAC name is piperidine-2-carboxylic acid;1,3-thiazolidine-2-carboxylic acid.
| Compound Name | piperidine-2-carboxylic acid;1,3-thiazolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 67719115 |
| Molecular Formula | C10H18N2O4S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | piperidine-2-carboxylic acid;1,3-thiazolidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCCN1.O=C(O)C1NCCS1 |
| InChI | InChI=1S/C6H11NO2.C4H7NO2S/c8-6(9)5-3-1-2-4-7-5;6-4(7)3-5-1-2-8-3/h5,7H,1-4H2,(H,8,9);3,5H,1-2H2,(H,6,7) |
| InChIKey | NGIYGNBDONFPIP-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |