C8H14N2O3S — CID 10171360
(4S)-4-amino-5-oxo-5-(1,3-thiazolidin-2-yl)pentanoic acid (PubChem CID 10171360) has the molecular formula C8H14N2O3S and a molecular weight of 218.28 g/mol. Its IUPAC name is (4S)-4-amino-5-oxo-5-(1,3-thiazolidin-2-yl)pentanoic acid.
| Compound Name | (4S)-4-amino-5-oxo-5-(1,3-thiazolidin-2-yl)pentanoic acid |
|---|---|
| PubChem CID | 10171360 |
| Molecular Formula | C8H14N2O3S |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | (4S)-4-amino-5-oxo-5-(1,3-thiazolidin-2-yl)pentanoic acid |
| SMILES | N[C@@H](CCC(=O)O)C(=O)C1NCCS1 |
| InChI | InChI=1S/C8H14N2O3S/c9-5(1-2-6(11)12)7(13)8-10-3-4-14-8/h5,8,10H,1-4,9H2,(H,11,12)/t5-,8?/m0/s1 |
| InChIKey | LCCXIXLPFWPVOB-NTFOPCPOSA-N |
| XLogP | -0.59 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |