C14H20N4O8 — CID 66840251
4-amino-5-[5-(2-amino-4-carboxybutanoyl)-3,6-dioxopiperazin-2-yl]-5-oxopentanoic acid (PubChem CID 66840251) has the molecular formula C14H20N4O8 and a molecular weight of 372.33 g/mol. Its IUPAC name is 4-amino-5-[5-(2-amino-4-carboxybutanoyl)-3,6-dioxopiperazin-2-yl]-5-oxopentanoic acid.
| Compound Name | 4-amino-5-[5-(2-amino-4-carboxybutanoyl)-3,6-dioxopiperazin-2-yl]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 66840251 |
| Molecular Formula | C14H20N4O8 |
| Molecular Weight | 372.33 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 4-amino-5-[5-(2-amino-4-carboxybutanoyl)-3,6-dioxopiperazin-2-yl]-5-oxopentanoic acid |
| SMILES | NC(CCC(=O)O)C(=O)C1NC(=O)C(C(=O)C(N)CCC(=O)O)NC1=O |
| InChI | InChI=1S/C14H20N4O8/c15-5(1-3-7(19)20)11(23)9-13(25)18-10(14(26)17-9)12(24)6(16)2-4-8(21)22/h5-6,9-10H,1-4,15-16H2,(H,17,26)(H,18,25)(H,19,20)(H,21,22) |
| InChIKey | DJUFQSSLTVQDBT-UHFFFAOYSA-N |
| XLogP | -3.51 |
| TPSA | 218.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.33 |
| LogP ≤ 5 | -3.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|