About 2-aminopentanedioic acid;piperidine
2-aminopentanedioic acid;piperidine (PubChem CID 19704542) has the molecular formula C10H20N2O4
and a molecular weight of 232.28 g/mol. Its IUPAC name is 2-aminopentanedioic acid;piperidine.
Molecular Properties
| Compound Name | 2-aminopentanedioic acid;piperidine |
| PubChem CID | 19704542 |
| Molecular Formula | C10H20N2O4 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | 2-aminopentanedioic acid;piperidine |
| SMILES | C1CCNCC1.NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C5H9NO4.C5H11N/c6-3(5(9)10)1-2-4(7)8;1-2-4-6-5-3-1/h3H,1-2,6H2,(H,7,8)(H,9,10);6H,1-5H2 |
| InChIKey | JZUYQMYQLYTELG-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-aminopentanedioic acid;piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminopentanedioic acid;piperidine?
The IUPAC name of 2-aminopentanedioic acid;piperidine (CID 19704542) is 2-aminopentanedioic acid;piperidine.
What is the SMILES notation for 2-aminopentanedioic acid;piperidine?
The canonical SMILES for 2-aminopentanedioic acid;piperidine is C1CCNCC1.NC(CCC(=O)O)C(=O)O.
What is the InChIKey of 2-aminopentanedioic acid;piperidine?
The InChIKey is JZUYQMYQLYTELG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO4.C5H11N/c6-3(5(9)10)1-2-4(7)8;1-2-4-6-5-3-1/h3H,1-2,6H2,(H,7,8)(H,9,10);6H,1-5H2.
What are the key properties of 2-aminopentanedioic acid;piperidine?
2-aminopentanedioic acid;piperidine has a molecular weight of 232.28 g/mol, XLogP of 0.02, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminopentanedioic acid;piperidine is sourced from PubChem (CID 19704542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).