C9H10ClN3OS — CID 123567068
N-(5-chloro-3-pyridinyl)-1,3-thiazolidine-2-carboxamide (PubChem CID 123567068) has the molecular formula C9H10ClN3OS and a molecular weight of 243.72 g/mol. Its IUPAC name is N-(5-chloro-3-pyridinyl)-1,3-thiazolidine-2-carboxamide.
| Compound Name | N-(5-chloro-3-pyridinyl)-1,3-thiazolidine-2-carboxamide |
|---|---|
| PubChem CID | 123567068 |
| Molecular Formula | C9H10ClN3OS |
| Molecular Weight | 243.72 g/mol |
| Exact Mass | 243.02 |
| IUPAC Name | N-(5-chloro-3-pyridinyl)-1,3-thiazolidine-2-carboxamide |
| SMILES | O=C(Nc1cncc(Cl)c1)C1NCCS1 |
| InChI | InChI=1S/C9H10ClN3OS/c10-6-3-7(5-11-4-6)13-8(14)9-12-1-2-15-9/h3-5,9,12H,1-2H2,(H,13,14) |
| InChIKey | SPOVOHNGOCCCAO-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.72 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |