C4H6NO2RbS — CID 59200106
rubidium(1+);(2R)-1,3-thiazolidine-2-carboxylate (PubChem CID 59200106) has the molecular formula C4H6NO2RbS and a molecular weight of 217.63 g/mol. Its IUPAC name is rubidium(1+);(2R)-1,3-thiazolidine-2-carboxylate.
| Compound Name | rubidium(1+);(2R)-1,3-thiazolidine-2-carboxylate |
|---|---|
| PubChem CID | 59200106 |
| Molecular Formula | C4H6NO2RbS |
| Molecular Weight | 217.63 g/mol |
| Exact Mass | 216.92 |
| IUPAC Name | rubidium(1+);(2R)-1,3-thiazolidine-2-carboxylate |
| SMILES | O=C([O-])[C@@H]1NCCS1.[Rb+] |
| InChI | InChI=1S/C4H7NO2S.Rb/c6-4(7)3-5-1-2-8-3;/h3,5H,1-2H2,(H,6,7);/q;+1/p-1/t3-;/m1./s1 |
| InChIKey | RSVOGMZKTBOKHI-AENDTGMFSA-M |
| XLogP | -4.60 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.63 |
| LogP ≤ 5 | -4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |