About rubidium(1+);(2R)-1,3-thiazolidine-2-carboxylate
rubidium(1+);(2R)-1,3-thiazolidine-2-carboxylate (PubChem CID 59200106) has the molecular formula C4H6NO2RbS
and a molecular weight of 217.63 g/mol. Its IUPAC name is rubidium(1+);(2R)-1,3-thiazolidine-2-carboxylate.
Molecular Properties
| Compound Name | rubidium(1+);(2R)-1,3-thiazolidine-2-carboxylate |
| PubChem CID | 59200106 |
| Molecular Formula | C4H6NO2RbS |
| Molecular Weight | 217.63 g/mol |
| Exact Mass | 216.92 |
| IUPAC Name | rubidium(1+);(2R)-1,3-thiazolidine-2-carboxylate |
| SMILES | O=C([O-])[C@@H]1NCCS1.[Rb+] |
| InChI | InChI=1S/C4H7NO2S.Rb/c6-4(7)3-5-1-2-8-3;/h3,5H,1-2H2,(H,6,7);/q;+1/p-1/t3-;/m1./s1 |
| InChIKey | RSVOGMZKTBOKHI-AENDTGMFSA-M |
| XLogP | -4.60 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.63 |
| LogP ≤ 5 | -4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze rubidium(1+);(2R)-1,3-thiazolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of rubidium(1+);(2R)-1,3-thiazolidine-2-carboxylate?
The IUPAC name of rubidium(1+);(2R)-1,3-thiazolidine-2-carboxylate (CID 59200106) is rubidium(1+);(2R)-1,3-thiazolidine-2-carboxylate.
What is the SMILES notation for rubidium(1+);(2R)-1,3-thiazolidine-2-carboxylate?
The canonical SMILES for rubidium(1+);(2R)-1,3-thiazolidine-2-carboxylate is O=C([O-])[C@@H]1NCCS1.[Rb+].
What is the InChIKey of rubidium(1+);(2R)-1,3-thiazolidine-2-carboxylate?
The InChIKey is RSVOGMZKTBOKHI-AENDTGMFSA-M. The full InChI is InChI=1S/C4H7NO2S.Rb/c6-4(7)3-5-1-2-8-3;/h3,5H,1-2H2,(H,6,7);/q;+1/p-1/t3-;/m1./s1.
What are the key properties of rubidium(1+);(2R)-1,3-thiazolidine-2-carboxylate?
rubidium(1+);(2R)-1,3-thiazolidine-2-carboxylate has a molecular weight of 217.63 g/mol, XLogP of -4.60, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for rubidium(1+);(2R)-1,3-thiazolidine-2-carboxylate is sourced from PubChem (CID 59200106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).