C9H8O2 — CID 101354786
[(2R,3S)-3-deuteriooxiran-2-yl]-phenylmethanone (PubChem CID 101354786) has the molecular formula C9H8O2 and a molecular weight of 149.17 g/mol. Its IUPAC name is [(2R,3S)-3-deuteriooxiran-2-yl]-phenylmethanone.
| Compound Name | [(2R,3S)-3-deuteriooxiran-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 101354786 |
| Molecular Formula | C9H8O2 |
| Molecular Weight | 149.17 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | [(2R,3S)-3-deuteriooxiran-2-yl]-phenylmethanone |
| SMILES | [2H][C@@H]1O[C@H]1C(=O)c1ccccc1 |
| InChI | InChI=1S/C9H8O2/c10-9(8-6-11-8)7-4-2-1-3-5-7/h1-5,8H,6H2/t8-/m1/s1/i6D/t6-,8+/m0 |
| InChIKey | BWQNUTOXKGPMMU-WVCCJZRMSA-N |
| XLogP | 1.27 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.17 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|