C14H16O2 — CID 78068098
(4,5-dimethyl-3,6-dihydro-2H-pyran-2-yl)-phenylmethanone (PubChem CID 78068098) has the molecular formula C14H16O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is (4,5-dimethyl-3,6-dihydro-2H-pyran-2-yl)-phenylmethanone.
| Compound Name | (4,5-dimethyl-3,6-dihydro-2H-pyran-2-yl)-phenylmethanone |
|---|---|
| PubChem CID | 78068098 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | (4,5-dimethyl-3,6-dihydro-2H-pyran-2-yl)-phenylmethanone |
| SMILES | CC1=C(C)CC(C(=O)c2ccccc2)OC1 |
| InChI | InChI=1S/C14H16O2/c1-10-8-13(16-9-11(10)2)14(15)12-6-4-3-5-7-12/h3-7,13H,8-9H2,1-2H3 |
| InChIKey | UQZTZHZDXPQMPU-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|