C17H17F5O — CID 11702712
[(1S,6S)-3,4-dimethyl-6-(1,1,2,2,2-pentafluoroethyl)cyclohex-3-en-1-yl]-phenylmethanone (PubChem CID 11702712) has the molecular formula C17H17F5O and a molecular weight of 332.31 g/mol. Its IUPAC name is [(1S,6S)-3,4-dimethyl-6-(1,1,2,2,2-pentafluoroethyl)cyclohex-3-en-1-yl]-phenylmethanone.
| Compound Name | [(1S,6S)-3,4-dimethyl-6-(1,1,2,2,2-pentafluoroethyl)cyclohex-3-en-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 11702712 |
| Molecular Formula | C17H17F5O |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | [(1S,6S)-3,4-dimethyl-6-(1,1,2,2,2-pentafluoroethyl)cyclohex-3-en-1-yl]-phenylmethanone |
| SMILES | CC1=C(C)C[C@H](C(F)(F)C(F)(F)F)[C@@H](C(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C17H17F5O/c1-10-8-13(15(23)12-6-4-3-5-7-12)14(9-11(10)2)16(18,19)17(20,21)22/h3-7,13-14H,8-9H2,1-2H3/t13-,14-/m0/s1 |
| InChIKey | NGBLVFKZJSVVNS-KBPBESRZSA-N |
| XLogP | 5.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|