C16H18O3 — CID 744231
(1S,6R)-6-benzoyl-3,4-dimethylcyclohex-3-ene-1-carboxylic acid (PubChem CID 744231) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is (1S,6R)-6-benzoyl-3,4-dimethylcyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,6R)-6-benzoyl-3,4-dimethylcyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 744231 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | (1S,6R)-6-benzoyl-3,4-dimethylcyclohex-3-ene-1-carboxylic acid |
| SMILES | CC1=C(C)C[C@@H](C(=O)c2ccccc2)[C@@H](C(=O)O)C1 |
| InChI | InChI=1S/C16H18O3/c1-10-8-13(14(16(18)19)9-11(10)2)15(17)12-6-4-3-5-7-12/h3-7,13-14H,8-9H2,1-2H3,(H,18,19)/t13-,14+/m1/s1 |
| InChIKey | NTBMZRJTZGTJRB-KGLIPLIRSA-N |
| XLogP | 3.32 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|