C17H16O — CID 15420517
[(1S,2R)-1-methyl-2,3-dihydro-1H-inden-2-yl]-phenylmethanone (PubChem CID 15420517) has the molecular formula C17H16O and a molecular weight of 236.31 g/mol. Its IUPAC name is [(1S,2R)-1-methyl-2,3-dihydro-1H-inden-2-yl]-phenylmethanone.
| Compound Name | [(1S,2R)-1-methyl-2,3-dihydro-1H-inden-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 15420517 |
| Molecular Formula | C17H16O |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | [(1S,2R)-1-methyl-2,3-dihydro-1H-inden-2-yl]-phenylmethanone |
| SMILES | C[C@@H]1c2ccccc2C[C@H]1C(=O)c1ccccc1 |
| InChI | InChI=1S/C17H16O/c1-12-15-10-6-5-9-14(15)11-16(12)17(18)13-7-3-2-4-8-13/h2-10,12,16H,11H2,1H3/t12-,16-/m1/s1 |
| InChIKey | HDSBUUBDQQZPJL-MLGOLLRUSA-N |
| XLogP | 3.85 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |