C10H11NO2 — CID 70327463
(1R,2S)-1-amino-2,3-dihydro-1H-indene-2-carboxylic acid (PubChem CID 70327463) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is (1R,2S)-1-amino-2,3-dihydro-1H-indene-2-carboxylic acid.
| Compound Name | (1R,2S)-1-amino-2,3-dihydro-1H-indene-2-carboxylic acid |
|---|---|
| PubChem CID | 70327463 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | (1R,2S)-1-amino-2,3-dihydro-1H-indene-2-carboxylic acid |
| SMILES | N[C@H]1c2ccccc2C[C@@H]1C(=O)O |
| InChI | InChI=1S/C10H11NO2/c11-9-7-4-2-1-3-6(7)5-8(9)10(12)13/h1-4,8-9H,5,11H2,(H,12,13)/t8-,9-/m0/s1 |
| InChIKey | DNDUYUYIRYKACW-IUCAKERBSA-N |
| XLogP | 0.94 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |