C11H14ClNO2 — CID 114986785
amino 1-methyl-2,3-dihydro-1H-indene-2-carboxylate;hydrochloride (PubChem CID 114986785) has the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. Its IUPAC name is amino 1-methyl-2,3-dihydro-1H-indene-2-carboxylate;hydrochloride.
| Compound Name | amino 1-methyl-2,3-dihydro-1H-indene-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 114986785 |
| Molecular Formula | C11H14ClNO2 |
| Molecular Weight | 227.69 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | amino 1-methyl-2,3-dihydro-1H-indene-2-carboxylate;hydrochloride |
| SMILES | CC1c2ccccc2CC1C(=O)ON.Cl |
| InChI | InChI=1S/C11H13NO2.ClH/c1-7-9-5-3-2-4-8(9)6-10(7)11(13)14-12;/h2-5,7,10H,6,12H2,1H3;1H |
| InChIKey | PAXKDCGJKCAXJN-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.69 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|