C15H18O5 — CID 13171844
dimethyl (1S,2R,3R)-1-methoxy-1,2,3,4-tetrahydronaphthalene-2,3-dicarboxylate (PubChem CID 13171844) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is dimethyl (1S,2R,3R)-1-methoxy-1,2,3,4-tetrahydronaphthalene-2,3-dicarboxylate.
| Compound Name | dimethyl (1S,2R,3R)-1-methoxy-1,2,3,4-tetrahydronaphthalene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 13171844 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | dimethyl (1S,2R,3R)-1-methoxy-1,2,3,4-tetrahydronaphthalene-2,3-dicarboxylate |
| SMILES | COC(=O)[C@H]1[C@H](OC)c2ccccc2C[C@H]1C(=O)OC |
| InChI | InChI=1S/C15H18O5/c1-18-13-10-7-5-4-6-9(10)8-11(14(16)19-2)12(13)15(17)20-3/h4-7,11-13H,8H2,1-3H3/t11-,12-,13-/m1/s1 |
| InChIKey | NXQPHAYBNBAXME-JHJVBQTASA-N |
| XLogP | 1.51 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |