C11H14O2 — CID 23270875
(1S,2S)-1,2-dimethoxy-2,3-dihydro-1H-indene (PubChem CID 23270875) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is (1S,2S)-1,2-dimethoxy-2,3-dihydro-1H-indene.
| Compound Name | (1S,2S)-1,2-dimethoxy-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 23270875 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | (1S,2S)-1,2-dimethoxy-2,3-dihydro-1H-indene |
| SMILES | CO[C@H]1Cc2ccccc2[C@@H]1OC |
| InChI | InChI=1S/C11H14O2/c1-12-10-7-8-5-3-4-6-9(8)11(10)13-2/h3-6,10-11H,7H2,1-2H3/t10-,11-/m0/s1 |
| InChIKey | UNIZBJQAEVZXDB-QWRGUYRKSA-N |
| XLogP | 1.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |