C18H15NO3 — CID 168865064
2-[(1S,2S)-2-methoxy-2,3-dihydro-1H-inden-1-yl]isoindole-1,3-dione (PubChem CID 168865064) has the molecular formula C18H15NO3 and a molecular weight of 293.32 g/mol. Its IUPAC name is 2-[(1S,2S)-2-methoxy-2,3-dihydro-1H-inden-1-yl]isoindole-1,3-dione.
| Compound Name | 2-[(1S,2S)-2-methoxy-2,3-dihydro-1H-inden-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 168865064 |
| Molecular Formula | C18H15NO3 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 2-[(1S,2S)-2-methoxy-2,3-dihydro-1H-inden-1-yl]isoindole-1,3-dione |
| SMILES | CO[C@H]1Cc2ccccc2[C@@H]1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H15NO3/c1-22-15-10-11-6-2-3-7-12(11)16(15)19-17(20)13-8-4-5-9-14(13)18(19)21/h2-9,15-16H,10H2,1H3/t15-,16-/m0/s1 |
| InChIKey | MEWDEUSMBOBGMI-HOTGVXAUSA-N |
| XLogP | 2.60 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|