C18H13NO3 — CID 23283664
2-(2-oxo-3,4-dihydro-1H-naphthalen-1-yl)isoindole-1,3-dione (PubChem CID 23283664) has the molecular formula C18H13NO3 and a molecular weight of 291.31 g/mol. Its IUPAC name is 2-(2-oxo-3,4-dihydro-1H-naphthalen-1-yl)isoindole-1,3-dione.
| Compound Name | 2-(2-oxo-3,4-dihydro-1H-naphthalen-1-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 23283664 |
| Molecular Formula | C18H13NO3 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 2-(2-oxo-3,4-dihydro-1H-naphthalen-1-yl)isoindole-1,3-dione |
| SMILES | O=C1CCc2ccccc2C1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H13NO3/c20-15-10-9-11-5-1-2-6-12(11)16(15)19-17(21)13-7-3-4-8-14(13)18(19)22/h1-8,16H,9-10H2 |
| InChIKey | LTNGKYFQCQGPLH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|