C19H15NO4 — CID 139247553
[1-(1,3-dioxoisoindol-2-yl)-2,3-dihydro-1H-inden-2-yl] acetate (PubChem CID 139247553) has the molecular formula C19H15NO4 and a molecular weight of 321.33 g/mol. Its IUPAC name is [1-(1,3-dioxoisoindol-2-yl)-2,3-dihydro-1H-inden-2-yl] acetate.
| Compound Name | [1-(1,3-dioxoisoindol-2-yl)-2,3-dihydro-1H-inden-2-yl] acetate |
|---|---|
| PubChem CID | 139247553 |
| Molecular Formula | C19H15NO4 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | [1-(1,3-dioxoisoindol-2-yl)-2,3-dihydro-1H-inden-2-yl] acetate |
| SMILES | CC(=O)OC1Cc2ccccc2C1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H15NO4/c1-11(21)24-16-10-12-6-2-3-7-13(12)17(16)20-18(22)14-8-4-5-9-15(14)19(20)23/h2-9,16-17H,10H2,1H3 |
| InChIKey | JFSMSZGPHYTYOP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|