C14H16HgO4 — CID 16683715
acetyloxy-(3-acetyloxy-1,2,3,4-tetrahydronaphthalen-2-yl)mercury (PubChem CID 16683715) has the molecular formula C14H16HgO4 and a molecular weight of 448.87 g/mol. Its IUPAC name is acetyloxy-(3-acetyloxy-1,2,3,4-tetrahydronaphthalen-2-yl)mercury.
| Compound Name | acetyloxy-(3-acetyloxy-1,2,3,4-tetrahydronaphthalen-2-yl)mercury |
|---|---|
| PubChem CID | 16683715 |
| Molecular Formula | C14H16HgO4 |
| Molecular Weight | 448.87 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | acetyloxy-(3-acetyloxy-1,2,3,4-tetrahydronaphthalen-2-yl)mercury |
| SMILES | CC(=O)O[Hg]C1Cc2ccccc2CC1OC(C)=O |
| InChI | InChI=1S/C12H13O2.C2H4O2.Hg/c1-9(13)14-12-7-6-10-4-2-3-5-11(10)8-12;1-2(3)4;/h2-5,7,12H,6,8H2,1H3;1H3,(H,3,4);/q;;+1/p-1 |
| InChIKey | ZZDCSIHYCCLHEI-UHFFFAOYSA-M |
| XLogP | 2.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.87 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|