About (5-ethenyl-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl) acetate
(5-ethenyl-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl) acetate (PubChem CID 140709226) has the molecular formula C12H12O2
and a molecular weight of 188.23 g/mol. Its IUPAC name is (5-ethenyl-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl) acetate.
Analyze (5-ethenyl-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-ethenyl-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl) acetate?
The IUPAC name of (5-ethenyl-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl) acetate (CID 140709226) is (5-ethenyl-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl) acetate.
What is the SMILES notation for (5-ethenyl-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl) acetate?
The canonical SMILES for (5-ethenyl-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl) acetate is C=Cc1cccc2c1C(OC(C)=O)C2.
What is the InChIKey of (5-ethenyl-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl) acetate?
The InChIKey is RFCKTMVBADCVKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O2/c1-3-9-5-4-6-10-7-11(12(9)10)14-8(2)13/h3-6,11H,1,7H2,2H3.
What are the key properties of (5-ethenyl-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl) acetate?
(5-ethenyl-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl) acetate has a molecular weight of 188.23 g/mol, XLogP of 2.49, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5-ethenyl-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl) acetate is sourced from PubChem (CID 140709226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).