About (1-methylidene-3,4-dihydro-2H-naphthalen-2-yl) acetate
(1-methylidene-3,4-dihydro-2H-naphthalen-2-yl) acetate (PubChem CID 100962209) has the molecular formula C13H14O2
and a molecular weight of 202.25 g/mol. Its IUPAC name is (1-methylidene-3,4-dihydro-2H-naphthalen-2-yl) acetate.
Analyze (1-methylidene-3,4-dihydro-2H-naphthalen-2-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylidene-3,4-dihydro-2H-naphthalen-2-yl) acetate?
The IUPAC name of (1-methylidene-3,4-dihydro-2H-naphthalen-2-yl) acetate (CID 100962209) is (1-methylidene-3,4-dihydro-2H-naphthalen-2-yl) acetate.
What is the SMILES notation for (1-methylidene-3,4-dihydro-2H-naphthalen-2-yl) acetate?
The canonical SMILES for (1-methylidene-3,4-dihydro-2H-naphthalen-2-yl) acetate is C=C1c2ccccc2CCC1OC(C)=O.
What is the InChIKey of (1-methylidene-3,4-dihydro-2H-naphthalen-2-yl) acetate?
The InChIKey is PHQJIBGHYLJLNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O2/c1-9-12-6-4-3-5-11(12)7-8-13(9)15-10(2)14/h3-6,13H,1,7-8H2,2H3.
What are the key properties of (1-methylidene-3,4-dihydro-2H-naphthalen-2-yl) acetate?
(1-methylidene-3,4-dihydro-2H-naphthalen-2-yl) acetate has a molecular weight of 202.25 g/mol, XLogP of 2.58, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylidene-3,4-dihydro-2H-naphthalen-2-yl) acetate is sourced from PubChem (CID 100962209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).