About 2-naphthalen-1-ylethyl acetate
2-naphthalen-1-ylethyl acetate (PubChem CID 592920) has the molecular formula C14H14O2
and a molecular weight of 214.26 g/mol. Its IUPAC name is 2-naphthalen-1-ylethyl acetate.
Molecular Properties
| Compound Name | 2-naphthalen-1-ylethyl acetate |
| PubChem CID | 592920 |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 2-naphthalen-1-ylethyl acetate |
| SMILES | CC(=O)OCCc1cccc2ccccc12 |
| InChI | InChI=1S/C14H14O2/c1-11(15)16-10-9-13-7-4-6-12-5-2-3-8-14(12)13/h2-8H,9-10H2,1H3 |
| InChIKey | ITZBHXFTXRVMIA-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-naphthalen-1-ylethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-naphthalen-1-ylethyl acetate?
The IUPAC name of 2-naphthalen-1-ylethyl acetate (CID 592920) is 2-naphthalen-1-ylethyl acetate.
What is the SMILES notation for 2-naphthalen-1-ylethyl acetate?
The canonical SMILES for 2-naphthalen-1-ylethyl acetate is CC(=O)OCCc1cccc2ccccc12.
What is the InChIKey of 2-naphthalen-1-ylethyl acetate?
The InChIKey is ITZBHXFTXRVMIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O2/c1-11(15)16-10-9-13-7-4-6-12-5-2-3-8-14(12)13/h2-8H,9-10H2,1H3.
What are the key properties of 2-naphthalen-1-ylethyl acetate?
2-naphthalen-1-ylethyl acetate has a molecular weight of 214.26 g/mol, XLogP of 2.95, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-naphthalen-1-ylethyl acetate is sourced from PubChem (CID 592920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).