About 2-naphthalen-1-ylethanol;2-naphthalen-1-ylethyl acetate
2-naphthalen-1-ylethanol;2-naphthalen-1-ylethyl acetate (PubChem CID 158105320) has the molecular formula C26H26O3
and a molecular weight of 386.49 g/mol. Its IUPAC name is 2-naphthalen-1-ylethanol;2-naphthalen-1-ylethyl acetate.
Molecular Properties
| Compound Name | 2-naphthalen-1-ylethanol;2-naphthalen-1-ylethyl acetate |
| PubChem CID | 158105320 |
| Molecular Formula | C26H26O3 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 2-naphthalen-1-ylethanol;2-naphthalen-1-ylethyl acetate |
| SMILES | CC(=O)OCCc1cccc2ccccc12.OCCc1cccc2ccccc12 |
| InChI | InChI=1S/C14H14O2.C12H12O/c1-11(15)16-10-9-13-7-4-6-12-5-2-3-8-14(12)13;13-9-8-11-6-3-5-10-4-1-2-7-12(10)11/h2-8H,9-10H2,1H3;1-7,13H,8-9H2 |
| InChIKey | FPTIHSIGGPOQRV-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-naphthalen-1-ylethanol;2-naphthalen-1-ylethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-naphthalen-1-ylethanol;2-naphthalen-1-ylethyl acetate?
The IUPAC name of 2-naphthalen-1-ylethanol;2-naphthalen-1-ylethyl acetate (CID 158105320) is 2-naphthalen-1-ylethanol;2-naphthalen-1-ylethyl acetate.
What is the SMILES notation for 2-naphthalen-1-ylethanol;2-naphthalen-1-ylethyl acetate?
The canonical SMILES for 2-naphthalen-1-ylethanol;2-naphthalen-1-ylethyl acetate is CC(=O)OCCc1cccc2ccccc12.OCCc1cccc2ccccc12.
What is the InChIKey of 2-naphthalen-1-ylethanol;2-naphthalen-1-ylethyl acetate?
The InChIKey is FPTIHSIGGPOQRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O2.C12H12O/c1-11(15)16-10-9-13-7-4-6-12-5-2-3-8-14(12)13;13-9-8-11-6-3-5-10-4-1-2-7-12(10)11/h2-8H,9-10H2,1H3;1-7,13H,8-9H2.
What are the key properties of 2-naphthalen-1-ylethanol;2-naphthalen-1-ylethyl acetate?
2-naphthalen-1-ylethanol;2-naphthalen-1-ylethyl acetate has a molecular weight of 386.49 g/mol, XLogP of 5.32, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-naphthalen-1-ylethanol;2-naphthalen-1-ylethyl acetate is sourced from PubChem (CID 158105320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).