About 3-naphthalen-1-ylpropyl carbamate
3-naphthalen-1-ylpropyl carbamate (PubChem CID 175301350) has the molecular formula C14H15NO2
and a molecular weight of 229.28 g/mol. Its IUPAC name is 3-naphthalen-1-ylpropyl carbamate.
Molecular Properties
| Compound Name | 3-naphthalen-1-ylpropyl carbamate |
| PubChem CID | 175301350 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 3-naphthalen-1-ylpropyl carbamate |
| SMILES | NC(=O)OCCCc1cccc2ccccc12 |
| InChI | InChI=1S/C14H15NO2/c15-14(16)17-10-4-8-12-7-3-6-11-5-1-2-9-13(11)12/h1-3,5-7,9H,4,8,10H2,(H2,15,16) |
| InChIKey | KQAZSAKUULQLTL-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-naphthalen-1-ylpropyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-naphthalen-1-ylpropyl carbamate?
The IUPAC name of 3-naphthalen-1-ylpropyl carbamate (CID 175301350) is 3-naphthalen-1-ylpropyl carbamate.
What is the SMILES notation for 3-naphthalen-1-ylpropyl carbamate?
The canonical SMILES for 3-naphthalen-1-ylpropyl carbamate is NC(=O)OCCCc1cccc2ccccc12.
What is the InChIKey of 3-naphthalen-1-ylpropyl carbamate?
The InChIKey is KQAZSAKUULQLTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO2/c15-14(16)17-10-4-8-12-7-3-6-11-5-1-2-9-13(11)12/h1-3,5-7,9H,4,8,10H2,(H2,15,16).
What are the key properties of 3-naphthalen-1-ylpropyl carbamate?
3-naphthalen-1-ylpropyl carbamate has a molecular weight of 229.28 g/mol, XLogP of 2.87, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-naphthalen-1-ylpropyl carbamate is sourced from PubChem (CID 175301350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).