C14H11F2O5S- — CID 58021629
1,1-difluoro-2-(2-naphthalen-1-ylethoxy)-2-oxoethanesulfonate (PubChem CID 58021629) has the molecular formula C14H11F2O5S- and a molecular weight of 329.30 g/mol. Its IUPAC name is 1,1-difluoro-2-(2-naphthalen-1-ylethoxy)-2-oxoethanesulfonate.
| Compound Name | 1,1-difluoro-2-(2-naphthalen-1-ylethoxy)-2-oxoethanesulfonate |
|---|---|
| PubChem CID | 58021629 |
| Molecular Formula | C14H11F2O5S- |
| Molecular Weight | 329.30 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | 1,1-difluoro-2-(2-naphthalen-1-ylethoxy)-2-oxoethanesulfonate |
| SMILES | O=C(OCCc1cccc2ccccc12)C(F)(F)S(=O)(=O)[O-] |
| InChI | InChI=1S/C14H12F2O5S/c15-14(16,22(18,19)20)13(17)21-9-8-11-6-3-5-10-4-1-2-7-12(10)11/h1-7H,8-9H2,(H,18,19,20)/p-1 |
| InChIKey | MMRXXDLDOFLFOZ-UHFFFAOYSA-M |
| XLogP | 2.06 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|