C16H14F2O7S — CID 87664747
1,1-difluoro-2-[2-(2-naphthalen-1-ylethoxy)-2-oxoethoxy]-2-oxoethanesulfonic acid (PubChem CID 87664747) has the molecular formula C16H14F2O7S and a molecular weight of 388.34 g/mol. Its IUPAC name is 1,1-difluoro-2-[2-(2-naphthalen-1-ylethoxy)-2-oxoethoxy]-2-oxoethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[2-(2-naphthalen-1-ylethoxy)-2-oxoethoxy]-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 87664747 |
| Molecular Formula | C16H14F2O7S |
| Molecular Weight | 388.34 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | 1,1-difluoro-2-[2-(2-naphthalen-1-ylethoxy)-2-oxoethoxy]-2-oxoethanesulfonic acid |
| SMILES | O=C(COC(=O)C(F)(F)S(=O)(=O)O)OCCc1cccc2ccccc12 |
| InChI | InChI=1S/C16H14F2O7S/c17-16(18,26(21,22)23)15(20)25-10-14(19)24-9-8-12-6-3-5-11-4-1-2-7-13(11)12/h1-7H,8-10H2,(H,21,22,23) |
| InChIKey | CAQBBGBGZGGJLE-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.34 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|