C13H10F4O4S — CID 59344324
1,1,2,2-tetrafluoro-2-(naphthalen-1-ylmethoxy)ethanesulfonic acid (PubChem CID 59344324) has the molecular formula C13H10F4O4S and a molecular weight of 338.28 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-(naphthalen-1-ylmethoxy)ethanesulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-2-(naphthalen-1-ylmethoxy)ethanesulfonic acid |
|---|---|
| PubChem CID | 59344324 |
| Molecular Formula | C13H10F4O4S |
| Molecular Weight | 338.28 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-(naphthalen-1-ylmethoxy)ethanesulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)OCc1cccc2ccccc12 |
| InChI | InChI=1S/C13H10F4O4S/c14-12(15,13(16,17)22(18,19)20)21-8-10-6-3-5-9-4-1-2-7-11(9)10/h1-7H,8H2,(H,18,19,20) |
| InChIKey | CKZFUVOOAAIFED-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.28 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|