C14H10F6O3S — CID 89249712
1,1,1,3,3,3-hexafluoro-2-(naphthalen-1-ylmethyl)propane-2-sulfonic acid (PubChem CID 89249712) has the molecular formula C14H10F6O3S and a molecular weight of 372.29 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-(naphthalen-1-ylmethyl)propane-2-sulfonic acid.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-(naphthalen-1-ylmethyl)propane-2-sulfonic acid |
|---|---|
| PubChem CID | 89249712 |
| Molecular Formula | C14H10F6O3S |
| Molecular Weight | 372.29 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-(naphthalen-1-ylmethyl)propane-2-sulfonic acid |
| SMILES | O=S(=O)(O)C(Cc1cccc2ccccc12)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H10F6O3S/c15-13(16,17)12(14(18,19)20,24(21,22)23)8-10-6-3-5-9-4-1-2-7-11(9)10/h1-7H,8H2,(H,21,22,23) |
| InChIKey | QPTZKJWTGFUWIX-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.29 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|