C17H9F13 — CID 10551907
1-[3,3,4,4,5,5,5-heptafluoro-2,2-bis(trifluoromethyl)pentyl]naphthalene (PubChem CID 10551907) has the molecular formula C17H9F13 and a molecular weight of 460.23 g/mol. Its IUPAC name is 1-[3,3,4,4,5,5,5-heptafluoro-2,2-bis(trifluoromethyl)pentyl]naphthalene.
| Compound Name | 1-[3,3,4,4,5,5,5-heptafluoro-2,2-bis(trifluoromethyl)pentyl]naphthalene |
|---|---|
| PubChem CID | 10551907 |
| Molecular Formula | C17H9F13 |
| Molecular Weight | 460.23 g/mol |
| Exact Mass | 460.05 |
| IUPAC Name | 1-[3,3,4,4,5,5,5-heptafluoro-2,2-bis(trifluoromethyl)pentyl]naphthalene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(Cc1cccc2ccccc12)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C17H9F13/c18-13(19,14(20,21)17(28,29)30)12(15(22,23)24,16(25,26)27)8-10-6-3-5-9-4-1-2-7-11(9)10/h1-7H,8H2 |
| InChIKey | OIALDJSDZCONIF-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.23 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|