C14H12F2O7S — CID 87412488
1,1-difluoro-2-[2-(5-hydroxynaphthalen-2-yl)oxyethoxy]-2-oxoethanesulfonic acid (PubChem CID 87412488) has the molecular formula C14H12F2O7S and a molecular weight of 362.31 g/mol. Its IUPAC name is 1,1-difluoro-2-[2-(5-hydroxynaphthalen-2-yl)oxyethoxy]-2-oxoethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[2-(5-hydroxynaphthalen-2-yl)oxyethoxy]-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 87412488 |
| Molecular Formula | C14H12F2O7S |
| Molecular Weight | 362.31 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | 1,1-difluoro-2-[2-(5-hydroxynaphthalen-2-yl)oxyethoxy]-2-oxoethanesulfonic acid |
| SMILES | O=C(OCCOc1ccc2c(O)cccc2c1)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C14H12F2O7S/c15-14(16,24(19,20)21)13(18)23-7-6-22-10-4-5-11-9(8-10)2-1-3-12(11)17/h1-5,8,17H,6-7H2,(H,19,20,21) |
| InChIKey | PFDLPXCBXBHRSY-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|