C19H14F2O7S — CID 87412420
2-[2-(anthracen-9-ylmethoxy)-2-oxoethoxy]-1,1-difluoro-2-oxoethanesulfonic acid (PubChem CID 87412420) has the molecular formula C19H14F2O7S and a molecular weight of 424.38 g/mol. Its IUPAC name is 2-[2-(anthracen-9-ylmethoxy)-2-oxoethoxy]-1,1-difluoro-2-oxoethanesulfonic acid.
| Compound Name | 2-[2-(anthracen-9-ylmethoxy)-2-oxoethoxy]-1,1-difluoro-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 87412420 |
| Molecular Formula | C19H14F2O7S |
| Molecular Weight | 424.38 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | 2-[2-(anthracen-9-ylmethoxy)-2-oxoethoxy]-1,1-difluoro-2-oxoethanesulfonic acid |
| SMILES | O=C(COC(=O)C(F)(F)S(=O)(=O)O)OCc1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C19H14F2O7S/c20-19(21,29(24,25)26)18(23)28-11-17(22)27-10-16-14-7-3-1-5-12(14)9-13-6-2-4-8-15(13)16/h1-9H,10-11H2,(H,24,25,26) |
| InChIKey | NNOGNJFJSVMBAD-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|