C33H41NO8 — CID 59987232
triethyl 8-(anthracen-9-ylmethoxycarbonylamino)octane-1,1,1-tricarboxylate (PubChem CID 59987232) has the molecular formula C33H41NO8 and a molecular weight of 579.69 g/mol. Its IUPAC name is triethyl 8-(anthracen-9-ylmethoxycarbonylamino)octane-1,1,1-tricarboxylate.
| Compound Name | triethyl 8-(anthracen-9-ylmethoxycarbonylamino)octane-1,1,1-tricarboxylate |
|---|---|
| PubChem CID | 59987232 |
| Molecular Formula | C33H41NO8 |
| Molecular Weight | 579.69 g/mol |
| Exact Mass | 579.28 |
| IUPAC Name | triethyl 8-(anthracen-9-ylmethoxycarbonylamino)octane-1,1,1-tricarboxylate |
| SMILES | CCOC(=O)C(CCCCCCCNC(=O)OCc1c2ccccc2cc2ccccc12)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C33H41NO8/c1-4-39-29(35)33(30(36)40-5-2,31(37)41-6-3)20-14-8-7-9-15-21-34-32(38)42-23-28-26-18-12-10-16-24(26)22-25-17-11-13-19-27(25)28/h10-13,16-19,22H,4-9,14-15,20-21,23H2,1-3H3,(H,34,38) |
| InChIKey | MRLOVBHDBBUWGV-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.69 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|