C26H32N2O3 — CID 102371145
tert-butyl N-[4-(3-anthracen-9-ylpropanoylamino)butyl]carbamate (PubChem CID 102371145) has the molecular formula C26H32N2O3 and a molecular weight of 420.55 g/mol. Its IUPAC name is tert-butyl N-[4-(3-anthracen-9-ylpropanoylamino)butyl]carbamate.
| Compound Name | tert-butyl N-[4-(3-anthracen-9-ylpropanoylamino)butyl]carbamate |
|---|---|
| PubChem CID | 102371145 |
| Molecular Formula | C26H32N2O3 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | tert-butyl N-[4-(3-anthracen-9-ylpropanoylamino)butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCNC(=O)CCc1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C26H32N2O3/c1-26(2,3)31-25(30)28-17-9-8-16-27-24(29)15-14-23-21-12-6-4-10-19(21)18-20-11-5-7-13-22(20)23/h4-7,10-13,18H,8-9,14-17H2,1-3H3,(H,27,29)(H,28,30) |
| InChIKey | QSOHHPPVEWJOHR-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|