C33H47N3O4 — CID 11489722
tert-butyl N-[4-(anthracen-9-ylmethylamino)butyl]-N-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]carbamate (PubChem CID 11489722) has the molecular formula C33H47N3O4 and a molecular weight of 549.76 g/mol. Its IUPAC name is tert-butyl N-[4-(anthracen-9-ylmethylamino)butyl]-N-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]carbamate.
| Compound Name | tert-butyl N-[4-(anthracen-9-ylmethylamino)butyl]-N-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]carbamate |
|---|---|
| PubChem CID | 11489722 |
| Molecular Formula | C33H47N3O4 |
| Molecular Weight | 549.76 g/mol |
| Exact Mass | 549.36 |
| IUPAC Name | tert-butyl N-[4-(anthracen-9-ylmethylamino)butyl]-N-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCN(CCCCNCc1c2ccccc2cc2ccccc12)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H47N3O4/c1-32(2,3)39-30(37)35-20-12-14-22-36(31(38)40-33(4,5)6)21-13-11-19-34-24-29-27-17-9-7-15-25(27)23-26-16-8-10-18-28(26)29/h7-10,15-18,23,34H,11-14,19-22,24H2,1-6H3,(H,35,37) |
| InChIKey | JUPQFIULHMUCMV-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.76 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|