C39H59N3O6 — CID 131744334
N-(anthracen-9-ylmethyl)octan-1-amine;(2S)-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (PubChem CID 131744334) has the molecular formula C39H59N3O6 and a molecular weight of 665.92 g/mol. Its IUPAC name is N-(anthracen-9-ylmethyl)octan-1-amine;(2S)-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid.
| Compound Name | N-(anthracen-9-ylmethyl)octan-1-amine;(2S)-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
|---|---|
| PubChem CID | 131744334 |
| Molecular Formula | C39H59N3O6 |
| Molecular Weight | 665.92 g/mol |
| Exact Mass | 665.44 |
| IUPAC Name | N-(anthracen-9-ylmethyl)octan-1-amine;(2S)-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@H](NC(=O)OC(C)(C)C)C(=O)O.CCCCCCCCNCc1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C23H29N.C16H30N2O6/c1-2-3-4-5-6-11-16-24-18-23-21-14-9-7-12-19(21)17-20-13-8-10-15-22(20)23;1-15(2,3)23-13(21)17-10-8-7-9-11(12(19)20)18-14(22)24-16(4,5)6/h7-10,12-15,17,24H,2-6,11,16,18H2,1H3;11H,7-10H2,1-6H3,(H,17,21)(H,18,22)(H,19,20)/t;11-/m.0/s1 |
| InChIKey | UWCHQFIUXUOHCL-WUSPCOQVSA-N |
| XLogP | 9.10 |
| TPSA | 125.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.92 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|