C28H39N3O2 — CID 10917346
tert-butyl N-[4-(4-aminobutylamino)butyl]-N-(anthracen-9-ylmethyl)carbamate (PubChem CID 10917346) has the molecular formula C28H39N3O2 and a molecular weight of 449.64 g/mol. Its IUPAC name is tert-butyl N-[4-(4-aminobutylamino)butyl]-N-(anthracen-9-ylmethyl)carbamate.
| Compound Name | tert-butyl N-[4-(4-aminobutylamino)butyl]-N-(anthracen-9-ylmethyl)carbamate |
|---|---|
| PubChem CID | 10917346 |
| Molecular Formula | C28H39N3O2 |
| Molecular Weight | 449.64 g/mol |
| Exact Mass | 449.30 |
| IUPAC Name | tert-butyl N-[4-(4-aminobutylamino)butyl]-N-(anthracen-9-ylmethyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCCCNCCCCN)Cc1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C28H39N3O2/c1-28(2,3)33-27(32)31(19-11-10-18-30-17-9-8-16-29)21-26-24-14-6-4-12-22(24)20-23-13-5-7-15-25(23)26/h4-7,12-15,20,30H,8-11,16-19,21,29H2,1-3H3 |
| InChIKey | YZDHWOZQHSGUOZ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.64 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|