C18H22N2O4 — CID 157399195
4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]quinoline-2-carboxylic acid (PubChem CID 157399195) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]quinoline-2-carboxylic acid.
| Compound Name | 4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]quinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 157399195 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]quinoline-2-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)NCCCc1cc(C(=O)O)nc2ccccc12 |
| InChI | InChI=1S/C18H22N2O4/c1-18(2,3)24-17(23)19-10-6-7-12-11-15(16(21)22)20-14-9-5-4-8-13(12)14/h4-5,8-9,11H,6-7,10H2,1-3H3,(H,19,23)(H,21,22) |
| InChIKey | BMYCBZILOXCNSX-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|