C23H29N5O2 — CID 57162552
tert-butyl N-[3-[[4-(benzylamino)quinazolin-2-yl]amino]propyl]carbamate (PubChem CID 57162552) has the molecular formula C23H29N5O2 and a molecular weight of 407.52 g/mol. Its IUPAC name is tert-butyl N-[3-[[4-(benzylamino)quinazolin-2-yl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[4-(benzylamino)quinazolin-2-yl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 57162552 |
| Molecular Formula | C23H29N5O2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | tert-butyl N-[3-[[4-(benzylamino)quinazolin-2-yl]amino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCNc1nc(NCc2ccccc2)c2ccccc2n1 |
| InChI | InChI=1S/C23H29N5O2/c1-23(2,3)30-22(29)25-15-9-14-24-21-27-19-13-8-7-12-18(19)20(28-21)26-16-17-10-5-4-6-11-17/h4-8,10-13H,9,14-16H2,1-3H3,(H,25,29)(H2,24,26,27,28) |
| InChIKey | WMZVNVUAKXNTHQ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|