C37H37F3N6O5 — CID 157309221
tert-butyl N-[2-[[2-[[4-[(4-phenylbenzoyl)amino]phenyl]methylamino]quinazolin-4-yl]amino]ethyl]carbamate;2,2,2-trifluoroacetic acid (PubChem CID 157309221) has the molecular formula C37H37F3N6O5 and a molecular weight of 702.73 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-[[4-[(4-phenylbenzoyl)amino]phenyl]methylamino]quinazolin-4-yl]amino]ethyl]carbamate;2,2,2-trifluoroacetic acid.
| Compound Name | tert-butyl N-[2-[[2-[[4-[(4-phenylbenzoyl)amino]phenyl]methylamino]quinazolin-4-yl]amino]ethyl]carbamate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 157309221 |
| Molecular Formula | C37H37F3N6O5 |
| Molecular Weight | 702.73 g/mol |
| Exact Mass | 702.28 |
| IUPAC Name | tert-butyl N-[2-[[2-[[4-[(4-phenylbenzoyl)amino]phenyl]methylamino]quinazolin-4-yl]amino]ethyl]carbamate;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)(C)OC(=O)NCCNc1nc(NCc2ccc(NC(=O)c3ccc(-c4ccccc4)cc3)cc2)nc2ccccc12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C35H36N6O3.C2HF3O2/c1-35(2,3)44-34(43)37-22-21-36-31-29-11-7-8-12-30(29)40-33(41-31)38-23-24-13-19-28(20-14-24)39-32(42)27-17-15-26(16-18-27)25-9-5-4-6-10-25;3-2(4,5)1(6)7/h4-20H,21-23H2,1-3H3,(H,37,43)(H,39,42)(H2,36,38,40,41);(H,6,7) |
| InChIKey | MGSBAVDGRCDYLW-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 154.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.73 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|