C27H22FN5O2 — CID 68940813
4-fluoro-N-[4-[[[2-(furan-2-ylmethylamino)quinazolin-4-yl]amino]methyl]phenyl]benzamide (PubChem CID 68940813) has the molecular formula C27H22FN5O2 and a molecular weight of 467.50 g/mol. Its IUPAC name is 4-fluoro-N-[4-[[[2-(furan-2-ylmethylamino)quinazolin-4-yl]amino]methyl]phenyl]benzamide.
| Compound Name | 4-fluoro-N-[4-[[[2-(furan-2-ylmethylamino)quinazolin-4-yl]amino]methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 68940813 |
| Molecular Formula | C27H22FN5O2 |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | 4-fluoro-N-[4-[[[2-(furan-2-ylmethylamino)quinazolin-4-yl]amino]methyl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(CNc2nc(NCc3ccco3)nc3ccccc23)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C27H22FN5O2/c28-20-11-9-19(10-12-20)26(34)31-21-13-7-18(8-14-21)16-29-25-23-5-1-2-6-24(23)32-27(33-25)30-17-22-4-3-15-35-22/h1-15H,16-17H2,(H,31,34)(H2,29,30,32,33) |
| InChIKey | CKWRKEGEENQUQW-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |