C22H19ClN6O — CID 25025706
2-chloro-N-[4-[[[2-(methylamino)quinazolin-4-yl]amino]methyl]phenyl]pyridine-3-carboxamide (PubChem CID 25025706) has the molecular formula C22H19ClN6O and a molecular weight of 418.89 g/mol. Its IUPAC name is 2-chloro-N-[4-[[[2-(methylamino)quinazolin-4-yl]amino]methyl]phenyl]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[4-[[[2-(methylamino)quinazolin-4-yl]amino]methyl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 25025706 |
| Molecular Formula | C22H19ClN6O |
| Molecular Weight | 418.89 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 2-chloro-N-[4-[[[2-(methylamino)quinazolin-4-yl]amino]methyl]phenyl]pyridine-3-carboxamide |
| SMILES | CNc1nc(NCc2ccc(NC(=O)c3cccnc3Cl)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C22H19ClN6O/c1-24-22-28-18-7-3-2-5-16(18)20(29-22)26-13-14-8-10-15(11-9-14)27-21(30)17-6-4-12-25-19(17)23/h2-12H,13H2,1H3,(H,27,30)(H2,24,26,28,29) |
| InChIKey | CTMSGNYEINNMPK-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.89 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|