C13H12ClN3O — CID 62167597
N-(4-chlorophenyl)-2-(methylamino)pyridine-3-carboxamide (PubChem CID 62167597) has the molecular formula C13H12ClN3O and a molecular weight of 261.71 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-(methylamino)pyridine-3-carboxamide.
| Compound Name | N-(4-chlorophenyl)-2-(methylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 62167597 |
| Molecular Formula | C13H12ClN3O |
| Molecular Weight | 261.71 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | N-(4-chlorophenyl)-2-(methylamino)pyridine-3-carboxamide |
| SMILES | CNc1ncccc1C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H12ClN3O/c1-15-12-11(3-2-8-16-12)13(18)17-10-6-4-9(14)5-7-10/h2-8H,1H3,(H,15,16)(H,17,18) |
| InChIKey | IBSBBIVUKAQRBE-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.71 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |