C19H16ClN3O2 — CID 23632593
N-(4-chlorophenyl)-2-(2-methoxyanilino)pyridine-3-carboxamide (PubChem CID 23632593) has the molecular formula C19H16ClN3O2 and a molecular weight of 353.81 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-(2-methoxyanilino)pyridine-3-carboxamide.
| Compound Name | N-(4-chlorophenyl)-2-(2-methoxyanilino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 23632593 |
| Molecular Formula | C19H16ClN3O2 |
| Molecular Weight | 353.81 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | N-(4-chlorophenyl)-2-(2-methoxyanilino)pyridine-3-carboxamide |
| SMILES | COc1ccccc1Nc1ncccc1C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H16ClN3O2/c1-25-17-7-3-2-6-16(17)23-18-15(5-4-12-21-18)19(24)22-14-10-8-13(20)9-11-14/h2-12H,1H3,(H,21,23)(H,22,24) |
| InChIKey | RGCXVALXIPCKHA-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.81 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |