C24H25N5O4S — CID 55968205
2-(2-methoxyanilino)-N-[4-[(Z)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]pyridine-3-carboxamide (PubChem CID 55968205) has the molecular formula C24H25N5O4S and a molecular weight of 479.56 g/mol. Its IUPAC name is 2-(2-methoxyanilino)-N-[4-[(Z)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]pyridine-3-carboxamide.
| Compound Name | 2-(2-methoxyanilino)-N-[4-[(Z)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 55968205 |
| Molecular Formula | C24H25N5O4S |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | 2-(2-methoxyanilino)-N-[4-[(Z)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]pyridine-3-carboxamide |
| SMILES | COc1ccccc1Nc1ncccc1C(=O)Nc1ccc(S(=O)(=O)/N=C2/CCCN2C)cc1 |
| InChI | InChI=1S/C24H25N5O4S/c1-29-16-6-10-22(29)28-34(31,32)18-13-11-17(12-14-18)26-24(30)19-7-5-15-25-23(19)27-20-8-3-4-9-21(20)33-2/h3-5,7-9,11-15H,6,10,16H2,1-2H3,(H,25,27)(H,26,30)/b28-22- |
| InChIKey | DXMDNFFOBJEWRD-SLMZUGIISA-N |
| XLogP | 3.90 |
| TPSA | 112.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|